C21H33N3O6 — CID 70351672
[2-[[[2-[2-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetyl]amino]methyl]cyclohexyl] nitrate (PubChem CID 70351672) has the molecular formula C21H33N3O6 and a molecular weight of 423.51 g/mol. Its IUPAC name is [2-[[[2-[2-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetyl]amino]methyl]cyclohexyl] nitrate.
| Compound Name | [2-[[[2-[2-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetyl]amino]methyl]cyclohexyl] nitrate |
|---|---|
| PubChem CID | 70351672 |
| Molecular Formula | C21H33N3O6 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | [2-[[[2-[2-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetyl]amino]methyl]cyclohexyl] nitrate |
| SMILES | CC(C)NCC(O)COc1ccccc1CC(=O)NCC1CCCCC1O[N+](=O)[O-] |
| InChI | InChI=1S/C21H33N3O6/c1-15(2)22-13-18(25)14-29-19-9-5-3-7-16(19)11-21(26)23-12-17-8-4-6-10-20(17)30-24(27)28/h3,5,7,9,15,17-18,20,22,25H,4,6,8,10-14H2,1-2H3,(H,23,26) |
| InChIKey | DDZCUEWQUFYBPI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|