C16H28ClNO2 — CID 21124907
1-(2-butylphenoxy)-3-(propan-2-ylamino)propan-2-ol;hydrochloride (PubChem CID 21124907) has the molecular formula C16H28ClNO2 and a molecular weight of 301.86 g/mol. Its IUPAC name is 1-(2-butylphenoxy)-3-(propan-2-ylamino)propan-2-ol;hydrochloride.
| Compound Name | 1-(2-butylphenoxy)-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 21124907 |
| Molecular Formula | C16H28ClNO2 |
| Molecular Weight | 301.86 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 1-(2-butylphenoxy)-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| SMILES | CCCCc1ccccc1OCC(O)CNC(C)C.Cl |
| InChI | InChI=1S/C16H27NO2.ClH/c1-4-5-8-14-9-6-7-10-16(14)19-12-15(18)11-17-13(2)3;/h6-7,9-10,13,15,17-18H,4-5,8,11-12H2,1-3H3;1H |
| InChIKey | HDZVFRRHEWONHX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.86 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |