C15H23Br2NO2 — CID 11329315
1-[2-(2,3-dibromopropyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol (PubChem CID 11329315) has the molecular formula C15H23Br2NO2 and a molecular weight of 409.16 g/mol. Its IUPAC name is 1-[2-(2,3-dibromopropyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 1-[2-(2,3-dibromopropyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 11329315 |
| Molecular Formula | C15H23Br2NO2 |
| Molecular Weight | 409.16 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 1-[2-(2,3-dibromopropyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)COc1ccccc1CC(Br)CBr |
| InChI | InChI=1S/C15H23Br2NO2/c1-11(2)18-9-14(19)10-20-15-6-4-3-5-12(15)7-13(17)8-16/h3-6,11,13-14,18-19H,7-10H2,1-2H3 |
| InChIKey | GZWBCHSPCJHFLS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.16 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|