C16H23Cl2NO2 — CID 23615940
1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;dihydrochloride (PubChem CID 23615940) has the molecular formula C16H23Cl2NO2 and a molecular weight of 332.27 g/mol. Its IUPAC name is 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;dihydrochloride.
| Compound Name | 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 23615940 |
| Molecular Formula | C16H23Cl2NO2 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;dihydrochloride |
| SMILES | CC(C)NCC(O)COc1cccc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C16H21NO2.2ClH/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16;;/h3-9,12,14,17-18H,10-11H2,1-2H3;2*1H |
| InChIKey | WRIIKRVFVCHXPS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |