C22H34ClN3O7 — CID 150042807
[(1R,2S)-2-[[[3-[[3-(5-chloro-2-methoxyphenoxy)-2-hydroxypropyl]amino]-3-methylbutanoyl]amino]methyl]cyclohexyl] nitrate (PubChem CID 150042807) has the molecular formula C22H34ClN3O7 and a molecular weight of 487.98 g/mol. Its IUPAC name is [(1R,2S)-2-[[[3-[[3-(5-chloro-2-methoxyphenoxy)-2-hydroxypropyl]amino]-3-methylbutanoyl]amino]methyl]cyclohexyl] nitrate.
| Compound Name | [(1R,2S)-2-[[[3-[[3-(5-chloro-2-methoxyphenoxy)-2-hydroxypropyl]amino]-3-methylbutanoyl]amino]methyl]cyclohexyl] nitrate |
|---|---|
| PubChem CID | 150042807 |
| Molecular Formula | C22H34ClN3O7 |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | [(1R,2S)-2-[[[3-[[3-(5-chloro-2-methoxyphenoxy)-2-hydroxypropyl]amino]-3-methylbutanoyl]amino]methyl]cyclohexyl] nitrate |
| SMILES | COc1ccc(Cl)cc1OCC(O)CNC(C)(C)CC(=O)NC[C@@H]1CCCC[C@H]1O[N+](=O)[O-] |
| InChI | InChI=1S/C22H34ClN3O7/c1-22(2,11-21(28)24-12-15-6-4-5-7-18(15)33-26(29)30)25-13-17(27)14-32-20-10-16(23)8-9-19(20)31-3/h8-10,15,17-18,25,27H,4-7,11-14H2,1-3H3,(H,24,28)/t15-,17?,18+/m0/s1 |
| InChIKey | DJQKYKQNZBILCK-DKKDMOBXSA-N |
| XLogP | 2.73 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|