C19H22ClNO4 — CID 8741288
1-[4-[(2S)-3-(5-chloro-2-methylanilino)-2-hydroxypropoxy]-3-methoxyphenyl]ethanone (PubChem CID 8741288) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is 1-[4-[(2S)-3-(5-chloro-2-methylanilino)-2-hydroxypropoxy]-3-methoxyphenyl]ethanone.
| Compound Name | 1-[4-[(2S)-3-(5-chloro-2-methylanilino)-2-hydroxypropoxy]-3-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 8741288 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-[4-[(2S)-3-(5-chloro-2-methylanilino)-2-hydroxypropoxy]-3-methoxyphenyl]ethanone |
| SMILES | COc1cc(C(C)=O)ccc1OC[C@@H](O)CNc1cc(Cl)ccc1C |
| InChI | InChI=1S/C19H22ClNO4/c1-12-4-6-15(20)9-17(12)21-10-16(23)11-25-18-7-5-14(13(2)22)8-19(18)24-3/h4-9,16,21,23H,10-11H2,1-3H3/t16-/m0/s1 |
| InChIKey | SPBHKAMUFWBTTH-INIZCTEOSA-N |
| XLogP | 3.71 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |