C16H26ClNO2 — CID 60904275
1-(5-chloro-2-methylanilino)-3-(4-methylpentan-2-yloxy)propan-2-ol (PubChem CID 60904275) has the molecular formula C16H26ClNO2 and a molecular weight of 299.84 g/mol. Its IUPAC name is 1-(5-chloro-2-methylanilino)-3-(4-methylpentan-2-yloxy)propan-2-ol.
| Compound Name | 1-(5-chloro-2-methylanilino)-3-(4-methylpentan-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 60904275 |
| Molecular Formula | C16H26ClNO2 |
| Molecular Weight | 299.84 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-(5-chloro-2-methylanilino)-3-(4-methylpentan-2-yloxy)propan-2-ol |
| SMILES | Cc1ccc(Cl)cc1NCC(O)COC(C)CC(C)C |
| InChI | InChI=1S/C16H26ClNO2/c1-11(2)7-13(4)20-10-15(19)9-18-16-8-14(17)6-5-12(16)3/h5-6,8,11,13,15,18-19H,7,9-10H2,1-4H3 |
| InChIKey | RBWYZLAQISSHMF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.84 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |