C14H22ClNO4 — CID 106989140
1-(5-chloro-2-methoxyanilino)-3-(1-methoxypropan-2-yloxy)propan-2-ol (PubChem CID 106989140) has the molecular formula C14H22ClNO4 and a molecular weight of 303.79 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyanilino)-3-(1-methoxypropan-2-yloxy)propan-2-ol.
| Compound Name | 1-(5-chloro-2-methoxyanilino)-3-(1-methoxypropan-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 106989140 |
| Molecular Formula | C14H22ClNO4 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-(5-chloro-2-methoxyanilino)-3-(1-methoxypropan-2-yloxy)propan-2-ol |
| SMILES | COCC(C)OCC(O)CNc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C14H22ClNO4/c1-10(8-18-2)20-9-12(17)7-16-13-6-11(15)4-5-14(13)19-3/h4-6,10,12,16-17H,7-9H2,1-3H3 |
| InChIKey | UXJUEAZJSBDLEI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |