C16H26ClNO3 — CID 60897922
1-(5-chloro-2-methoxyanilino)-3-hexoxypropan-2-ol (PubChem CID 60897922) has the molecular formula C16H26ClNO3 and a molecular weight of 315.84 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyanilino)-3-hexoxypropan-2-ol.
| Compound Name | 1-(5-chloro-2-methoxyanilino)-3-hexoxypropan-2-ol |
|---|---|
| PubChem CID | 60897922 |
| Molecular Formula | C16H26ClNO3 |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-(5-chloro-2-methoxyanilino)-3-hexoxypropan-2-ol |
| SMILES | CCCCCCOCC(O)CNc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C16H26ClNO3/c1-3-4-5-6-9-21-12-14(19)11-18-15-10-13(17)7-8-16(15)20-2/h7-8,10,14,18-19H,3-6,9,11-12H2,1-2H3 |
| InChIKey | NQIOUHRYOJUAHB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|