C15H23BrFNO2 — CID 60910056
1-(5-bromo-2-fluoroanilino)-3-hexoxypropan-2-ol (PubChem CID 60910056) has the molecular formula C15H23BrFNO2 and a molecular weight of 348.26 g/mol. Its IUPAC name is 1-(5-bromo-2-fluoroanilino)-3-hexoxypropan-2-ol.
| Compound Name | 1-(5-bromo-2-fluoroanilino)-3-hexoxypropan-2-ol |
|---|---|
| PubChem CID | 60910056 |
| Molecular Formula | C15H23BrFNO2 |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-(5-bromo-2-fluoroanilino)-3-hexoxypropan-2-ol |
| SMILES | CCCCCCOCC(O)CNc1cc(Br)ccc1F |
| InChI | InChI=1S/C15H23BrFNO2/c1-2-3-4-5-8-20-11-13(19)10-18-15-9-12(16)6-7-14(15)17/h6-7,9,13,18-19H,2-5,8,10-11H2,1H3 |
| InChIKey | HANZGAQOBRMAFU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|