C32H60N2O5 — CID 155231458
2,3-bis[(3-decoxy-2-hydroxypropyl)amino]phenol (PubChem CID 155231458) has the molecular formula C32H60N2O5 and a molecular weight of 552.84 g/mol. Its IUPAC name is 2,3-bis[(3-decoxy-2-hydroxypropyl)amino]phenol.
| Compound Name | 2,3-bis[(3-decoxy-2-hydroxypropyl)amino]phenol |
|---|---|
| PubChem CID | 155231458 |
| Molecular Formula | C32H60N2O5 |
| Molecular Weight | 552.84 g/mol |
| Exact Mass | 552.45 |
| IUPAC Name | 2,3-bis[(3-decoxy-2-hydroxypropyl)amino]phenol |
| SMILES | CCCCCCCCCCOCC(O)CNc1cccc(O)c1NCC(O)COCCCCCCCCCC |
| InChI | InChI=1S/C32H60N2O5/c1-3-5-7-9-11-13-15-17-22-38-26-28(35)24-33-30-20-19-21-31(37)32(30)34-25-29(36)27-39-23-18-16-14-12-10-8-6-4-2/h19-21,28-29,33-37H,3-18,22-27H2,1-2H3 |
| InChIKey | RNONBXUXZHAVAN-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 103.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.84 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|