C15H23ClFNO2 — CID 60908651
1-(5-chloro-2-fluoroanilino)-3-hexoxypropan-2-ol (PubChem CID 60908651) has the molecular formula C15H23ClFNO2 and a molecular weight of 303.80 g/mol. Its IUPAC name is 1-(5-chloro-2-fluoroanilino)-3-hexoxypropan-2-ol.
| Compound Name | 1-(5-chloro-2-fluoroanilino)-3-hexoxypropan-2-ol |
|---|---|
| PubChem CID | 60908651 |
| Molecular Formula | C15H23ClFNO2 |
| Molecular Weight | 303.80 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1-(5-chloro-2-fluoroanilino)-3-hexoxypropan-2-ol |
| SMILES | CCCCCCOCC(O)CNc1cc(Cl)ccc1F |
| InChI | InChI=1S/C15H23ClFNO2/c1-2-3-4-5-8-20-11-13(19)10-18-15-9-12(16)6-7-14(15)17/h6-7,9,13,18-19H,2-5,8,10-11H2,1H3 |
| InChIKey | QGIHEBJRIKMSIU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.80 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|