C13H20ClNO4 — CID 106989141
1-(5-chloro-2-methoxyanilino)-3-(2-methoxyethoxy)propan-2-ol (PubChem CID 106989141) has the molecular formula C13H20ClNO4 and a molecular weight of 289.76 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyanilino)-3-(2-methoxyethoxy)propan-2-ol.
| Compound Name | 1-(5-chloro-2-methoxyanilino)-3-(2-methoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 106989141 |
| Molecular Formula | C13H20ClNO4 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 1-(5-chloro-2-methoxyanilino)-3-(2-methoxyethoxy)propan-2-ol |
| SMILES | COCCOCC(O)CNc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C13H20ClNO4/c1-17-5-6-19-9-11(16)8-15-12-7-10(14)3-4-13(12)18-2/h3-4,7,11,15-16H,5-6,8-9H2,1-2H3 |
| InChIKey | GTQGMIODQDQEFE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|