C16H25BrFNO2 — CID 107592126
1-(5-bromo-4-fluoro-2-methylanilino)-3-(4-methylpentan-2-yloxy)propan-2-ol (PubChem CID 107592126) has the molecular formula C16H25BrFNO2 and a molecular weight of 362.28 g/mol. Its IUPAC name is 1-(5-bromo-4-fluoro-2-methylanilino)-3-(4-methylpentan-2-yloxy)propan-2-ol.
| Compound Name | 1-(5-bromo-4-fluoro-2-methylanilino)-3-(4-methylpentan-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 107592126 |
| Molecular Formula | C16H25BrFNO2 |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-(5-bromo-4-fluoro-2-methylanilino)-3-(4-methylpentan-2-yloxy)propan-2-ol |
| SMILES | Cc1cc(F)c(Br)cc1NCC(O)COC(C)CC(C)C |
| InChI | InChI=1S/C16H25BrFNO2/c1-10(2)5-12(4)21-9-13(20)8-19-16-7-14(17)15(18)6-11(16)3/h6-7,10,12-13,19-20H,5,8-9H2,1-4H3 |
| InChIKey | GTHPNCBJOWHGSV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |