C12H17BrFNO2 — CID 107591894
1-(5-bromo-4-fluoro-2-methylanilino)-3-ethoxypropan-2-ol (PubChem CID 107591894) has the molecular formula C12H17BrFNO2 and a molecular weight of 306.18 g/mol. Its IUPAC name is 1-(5-bromo-4-fluoro-2-methylanilino)-3-ethoxypropan-2-ol.
| Compound Name | 1-(5-bromo-4-fluoro-2-methylanilino)-3-ethoxypropan-2-ol |
|---|---|
| PubChem CID | 107591894 |
| Molecular Formula | C12H17BrFNO2 |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 1-(5-bromo-4-fluoro-2-methylanilino)-3-ethoxypropan-2-ol |
| SMILES | CCOCC(O)CNc1cc(Br)c(F)cc1C |
| InChI | InChI=1S/C12H17BrFNO2/c1-3-17-7-9(16)6-15-12-5-10(13)11(14)4-8(12)2/h4-5,9,15-16H,3,6-7H2,1-2H3 |
| InChIKey | KQGRISGINPWGHK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |