C12H15FN2O2 — CID 79003913
4-[(3-ethoxy-2-hydroxypropyl)amino]-3-fluorobenzonitrile (PubChem CID 79003913) has the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. Its IUPAC name is 4-[(3-ethoxy-2-hydroxypropyl)amino]-3-fluorobenzonitrile.
| Compound Name | 4-[(3-ethoxy-2-hydroxypropyl)amino]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 79003913 |
| Molecular Formula | C12H15FN2O2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4-[(3-ethoxy-2-hydroxypropyl)amino]-3-fluorobenzonitrile |
| SMILES | CCOCC(O)CNc1ccc(C#N)cc1F |
| InChI | InChI=1S/C12H15FN2O2/c1-2-17-8-10(16)7-15-12-4-3-9(6-14)5-11(12)13/h3-5,10,15-16H,2,7-8H2,1H3 |
| InChIKey | QJRLJEUDMIETJA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |