C11H12FNO2 — CID 168594947
3-(4-ethynyl-2-fluoroanilino)propane-1,2-diol (PubChem CID 168594947) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is 3-(4-ethynyl-2-fluoroanilino)propane-1,2-diol.
| Compound Name | 3-(4-ethynyl-2-fluoroanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 168594947 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 3-(4-ethynyl-2-fluoroanilino)propane-1,2-diol |
| SMILES | C#Cc1ccc(NCC(O)CO)c(F)c1 |
| InChI | InChI=1S/C11H12FNO2/c1-2-8-3-4-11(10(12)5-8)13-6-9(15)7-14/h1,3-5,9,13-15H,6-7H2 |
| InChIKey | SDPMXVKHOZSTEI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|