C9H10BrF2NO2 — CID 102853500
(2S)-3-(5-bromo-2,4-difluoroanilino)propane-1,2-diol (PubChem CID 102853500) has the molecular formula C9H10BrF2NO2 and a molecular weight of 282.08 g/mol. Its IUPAC name is (2S)-3-(5-bromo-2,4-difluoroanilino)propane-1,2-diol.
| Compound Name | (2S)-3-(5-bromo-2,4-difluoroanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 102853500 |
| Molecular Formula | C9H10BrF2NO2 |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | (2S)-3-(5-bromo-2,4-difluoroanilino)propane-1,2-diol |
| SMILES | OC[C@@H](O)CNc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C9H10BrF2NO2/c10-6-1-9(8(12)2-7(6)11)13-3-5(15)4-14/h1-2,5,13-15H,3-4H2/t5-/m0/s1 |
| InChIKey | VUODUUUTPXAYRD-YFKPBYRVSA-N |
| XLogP | 1.49 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|