C12H16BrF2N — CID 102852837
5-bromo-2,4-difluoro-N-(2-methylpentyl)aniline (PubChem CID 102852837) has the molecular formula C12H16BrF2N and a molecular weight of 292.17 g/mol. Its IUPAC name is 5-bromo-2,4-difluoro-N-(2-methylpentyl)aniline.
| Compound Name | 5-bromo-2,4-difluoro-N-(2-methylpentyl)aniline |
|---|---|
| PubChem CID | 102852837 |
| Molecular Formula | C12H16BrF2N |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 5-bromo-2,4-difluoro-N-(2-methylpentyl)aniline |
| SMILES | CCCC(C)CNc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C12H16BrF2N/c1-3-4-8(2)7-16-12-5-9(13)10(14)6-11(12)15/h5-6,8,16H,3-4,7H2,1-2H3 |
| InChIKey | XJUDZGUIPPOEKY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|