C13H17BrFNO2 — CID 107591791
ethyl 3-(5-bromo-4-fluoro-2-methylanilino)-2-methylpropanoate (PubChem CID 107591791) has the molecular formula C13H17BrFNO2 and a molecular weight of 318.19 g/mol. Its IUPAC name is ethyl 3-(5-bromo-4-fluoro-2-methylanilino)-2-methylpropanoate.
| Compound Name | ethyl 3-(5-bromo-4-fluoro-2-methylanilino)-2-methylpropanoate |
|---|---|
| PubChem CID | 107591791 |
| Molecular Formula | C13H17BrFNO2 |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | ethyl 3-(5-bromo-4-fluoro-2-methylanilino)-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)CNc1cc(Br)c(F)cc1C |
| InChI | InChI=1S/C13H17BrFNO2/c1-4-18-13(17)9(3)7-16-12-6-10(14)11(15)5-8(12)2/h5-6,9,16H,4,7H2,1-3H3 |
| InChIKey | LNSDUEOPTDKBIO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |