C9H10ClF2NO2 — CID 168593942
3-(2-chloro-3,5-difluoroanilino)propane-1,2-diol (PubChem CID 168593942) has the molecular formula C9H10ClF2NO2 and a molecular weight of 237.63 g/mol. Its IUPAC name is 3-(2-chloro-3,5-difluoroanilino)propane-1,2-diol.
| Compound Name | 3-(2-chloro-3,5-difluoroanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 168593942 |
| Molecular Formula | C9H10ClF2NO2 |
| Molecular Weight | 237.63 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 3-(2-chloro-3,5-difluoroanilino)propane-1,2-diol |
| SMILES | OCC(O)CNc1cc(F)cc(F)c1Cl |
| InChI | InChI=1S/C9H10ClF2NO2/c10-9-7(12)1-5(11)2-8(9)13-3-6(15)4-14/h1-2,6,13-15H,3-4H2 |
| InChIKey | ZCBIAGBDUQKUCS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.63 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|