C9H13ClN2O2 — CID 66176348
3-(4-amino-2-chloroanilino)propane-1,2-diol (PubChem CID 66176348) has the molecular formula C9H13ClN2O2 and a molecular weight of 216.67 g/mol. Its IUPAC name is 3-(4-amino-2-chloroanilino)propane-1,2-diol.
| Compound Name | 3-(4-amino-2-chloroanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 66176348 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 3-(4-amino-2-chloroanilino)propane-1,2-diol |
| SMILES | Nc1ccc(NCC(O)CO)c(Cl)c1 |
| InChI | InChI=1S/C9H13ClN2O2/c10-8-3-6(11)1-2-9(8)12-4-7(14)5-13/h1-3,7,12-14H,4-5,11H2 |
| InChIKey | AZPDVSIRVXLOTH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|