C17H22N2O4 — CID 18371616
3-[4-amino-2-(3,5-dimethoxyphenyl)anilino]propane-1,2-diol (PubChem CID 18371616) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-[4-amino-2-(3,5-dimethoxyphenyl)anilino]propane-1,2-diol.
| Compound Name | 3-[4-amino-2-(3,5-dimethoxyphenyl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 18371616 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 3-[4-amino-2-(3,5-dimethoxyphenyl)anilino]propane-1,2-diol |
| SMILES | COc1cc(OC)cc(-c2cc(N)ccc2NCC(O)CO)c1 |
| InChI | InChI=1S/C17H22N2O4/c1-22-14-5-11(6-15(8-14)23-2)16-7-12(18)3-4-17(16)19-9-13(21)10-20/h3-8,13,19-21H,9-10,18H2,1-2H3 |
| InChIKey | BGHRPIJSFBLPGZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|