C13H17N3O2 — CID 23286915
3-[4-amino-2-(1H-pyrrol-3-yl)anilino]propane-1,2-diol (PubChem CID 23286915) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 3-[4-amino-2-(1H-pyrrol-3-yl)anilino]propane-1,2-diol.
| Compound Name | 3-[4-amino-2-(1H-pyrrol-3-yl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 23286915 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 3-[4-amino-2-(1H-pyrrol-3-yl)anilino]propane-1,2-diol |
| SMILES | Nc1ccc(NCC(O)CO)c(-c2cc[nH]c2)c1 |
| InChI | InChI=1S/C13H17N3O2/c14-10-1-2-13(16-7-11(18)8-17)12(5-10)9-3-4-15-6-9/h1-6,11,15-18H,7-8,14H2 |
| InChIKey | FXSDMSSAOLEOFN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|