C7H12N2O2 — CID 115121889
3-(1H-pyrrol-3-ylamino)propane-1,2-diol (PubChem CID 115121889) has the molecular formula C7H12N2O2 and a molecular weight of 156.19 g/mol. Its IUPAC name is 3-(1H-pyrrol-3-ylamino)propane-1,2-diol.
| Compound Name | 3-(1H-pyrrol-3-ylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 115121889 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 3-(1H-pyrrol-3-ylamino)propane-1,2-diol |
| SMILES | OCC(O)CNc1cc[nH]c1 |
| InChI | InChI=1S/C7H12N2O2/c10-5-7(11)4-9-6-1-2-8-3-6/h1-3,7-11H,4-5H2 |
| InChIKey | QPFMNBVOTVNOKD-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |