C8H13N3O2 — CID 115241470
3-amino-4-(1H-pyrrol-3-ylamino)butanoic acid (PubChem CID 115241470) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-amino-4-(1H-pyrrol-3-ylamino)butanoic acid.
| Compound Name | 3-amino-4-(1H-pyrrol-3-ylamino)butanoic acid |
|---|---|
| PubChem CID | 115241470 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 3-amino-4-(1H-pyrrol-3-ylamino)butanoic acid |
| SMILES | NC(CNc1cc[nH]c1)CC(=O)O |
| InChI | InChI=1S/C8H13N3O2/c9-6(3-8(12)13)4-11-7-1-2-10-5-7/h1-2,5-6,10-11H,3-4,9H2,(H,12,13) |
| InChIKey | QVTHBSWMVHEAMB-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |