C13H20N2O4 — CID 115241480
3-amino-4-(4,5-dimethoxy-2-methylanilino)butanoic acid (PubChem CID 115241480) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-amino-4-(4,5-dimethoxy-2-methylanilino)butanoic acid.
| Compound Name | 3-amino-4-(4,5-dimethoxy-2-methylanilino)butanoic acid |
|---|---|
| PubChem CID | 115241480 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-amino-4-(4,5-dimethoxy-2-methylanilino)butanoic acid |
| SMILES | COc1cc(C)c(NCC(N)CC(=O)O)cc1OC |
| InChI | InChI=1S/C13H20N2O4/c1-8-4-11(18-2)12(19-3)6-10(8)15-7-9(14)5-13(16)17/h4,6,9,15H,5,7,14H2,1-3H3,(H,16,17) |
| InChIKey | HSDGQZBMVYORBL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|