C11H15NO3 — CID 82492559
2-(4-methoxy-2,5-dimethylanilino)acetic acid (PubChem CID 82492559) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-(4-methoxy-2,5-dimethylanilino)acetic acid.
| Compound Name | 2-(4-methoxy-2,5-dimethylanilino)acetic acid |
|---|---|
| PubChem CID | 82492559 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-(4-methoxy-2,5-dimethylanilino)acetic acid |
| SMILES | COc1cc(C)c(NCC(=O)O)cc1C |
| InChI | InChI=1S/C11H15NO3/c1-7-5-10(15-3)8(2)4-9(7)12-6-11(13)14/h4-5,12H,6H2,1-3H3,(H,13,14) |
| InChIKey | QRUIFVSOACUHDT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|