C12H16N2O4 — CID 115179087
2-amino-3-(4-methoxy-2,5-dimethylanilino)-3-oxopropanoic acid (PubChem CID 115179087) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-amino-3-(4-methoxy-2,5-dimethylanilino)-3-oxopropanoic acid.
| Compound Name | 2-amino-3-(4-methoxy-2,5-dimethylanilino)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 115179087 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-amino-3-(4-methoxy-2,5-dimethylanilino)-3-oxopropanoic acid |
| SMILES | COc1cc(C)c(NC(=O)C(N)C(=O)O)cc1C |
| InChI | InChI=1S/C12H16N2O4/c1-6-5-9(18-3)7(2)4-8(6)14-11(15)10(13)12(16)17/h4-5,10H,13H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | YRLMHGGFVFETEA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|