C10H14N2O3 — CID 82492626
(4,5-dimethoxy-2-methylphenyl)urea (PubChem CID 82492626) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)urea.
| Compound Name | (4,5-dimethoxy-2-methylphenyl)urea |
|---|---|
| PubChem CID | 82492626 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl)urea |
| SMILES | COc1cc(C)c(NC(N)=O)cc1OC |
| InChI | InChI=1S/C10H14N2O3/c1-6-4-8(14-2)9(15-3)5-7(6)12-10(11)13/h4-5H,1-3H3,(H3,11,12,13) |
| InChIKey | CKQBKJMLBNCLPX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |