C13H20N2O3 — CID 79024477
(2S)-2-amino-N-(4,5-dimethoxy-2-methylphenyl)butanamide (PubChem CID 79024477) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is (2S)-2-amino-N-(4,5-dimethoxy-2-methylphenyl)butanamide.
| Compound Name | (2S)-2-amino-N-(4,5-dimethoxy-2-methylphenyl)butanamide |
|---|---|
| PubChem CID | 79024477 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (2S)-2-amino-N-(4,5-dimethoxy-2-methylphenyl)butanamide |
| SMILES | CC[C@H](N)C(=O)Nc1cc(OC)c(OC)cc1C |
| InChI | InChI=1S/C13H20N2O3/c1-5-9(14)13(16)15-10-7-12(18-4)11(17-3)6-8(10)2/h6-7,9H,5,14H2,1-4H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | XTHLSKSAKIIKQW-VIFPVBQESA-N |
| XLogP | 1.69 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |