C13H19N3O4 — CID 119307644
2-[[(2S)-2-aminobutanoyl]amino]-4,5-dimethoxybenzamide (PubChem CID 119307644) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-[[(2S)-2-aminobutanoyl]amino]-4,5-dimethoxybenzamide.
| Compound Name | 2-[[(2S)-2-aminobutanoyl]amino]-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 119307644 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-[[(2S)-2-aminobutanoyl]amino]-4,5-dimethoxybenzamide |
| SMILES | CC[C@H](N)C(=O)Nc1cc(OC)c(OC)cc1C(N)=O |
| InChI | InChI=1S/C13H19N3O4/c1-4-8(14)13(18)16-9-6-11(20-3)10(19-2)5-7(9)12(15)17/h5-6,8H,4,14H2,1-3H3,(H2,15,17)(H,16,18)/t8-/m0/s1 |
| InChIKey | YFNKLQURMLOALG-QMMMGPOBSA-N |
| XLogP | 0.48 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |