C12H18N2O5 — CID 168595303
2-(2,3-dihydroxypropylamino)-4,5-dimethoxybenzamide (PubChem CID 168595303) has the molecular formula C12H18N2O5 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylamino)-4,5-dimethoxybenzamide.
| Compound Name | 2-(2,3-dihydroxypropylamino)-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 168595303 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(2,3-dihydroxypropylamino)-4,5-dimethoxybenzamide |
| SMILES | COc1cc(NCC(O)CO)c(C(N)=O)cc1OC |
| InChI | InChI=1S/C12H18N2O5/c1-18-10-3-8(12(13)17)9(4-11(10)19-2)14-5-7(16)6-15/h3-4,7,14-16H,5-6H2,1-2H3,(H2,13,17) |
| InChIKey | IXPOKULKQBTKGM-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|