C11H13ClFNO4 — CID 168638584
2-[(3-chloro-2-hydroxypropyl)amino]-4-fluoro-5-methoxybenzoic acid (PubChem CID 168638584) has the molecular formula C11H13ClFNO4 and a molecular weight of 277.68 g/mol. Its IUPAC name is 2-[(3-chloro-2-hydroxypropyl)amino]-4-fluoro-5-methoxybenzoic acid.
| Compound Name | 2-[(3-chloro-2-hydroxypropyl)amino]-4-fluoro-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 168638584 |
| Molecular Formula | C11H13ClFNO4 |
| Molecular Weight | 277.68 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-[(3-chloro-2-hydroxypropyl)amino]-4-fluoro-5-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)c(NCC(O)CCl)cc1F |
| InChI | InChI=1S/C11H13ClFNO4/c1-18-10-2-7(11(16)17)9(3-8(10)13)14-5-6(15)4-12/h2-3,6,14-15H,4-5H2,1H3,(H,16,17) |
| InChIKey | ZJPRGWKOHHZCQA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.68 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|