C15H22ClNO5 — CID 168640097
methyl 2-[(3-chloro-2-hydroxypropyl)amino]-4,5-diethoxybenzoate (PubChem CID 168640097) has the molecular formula C15H22ClNO5 and a molecular weight of 331.80 g/mol. Its IUPAC name is methyl 2-[(3-chloro-2-hydroxypropyl)amino]-4,5-diethoxybenzoate.
| Compound Name | methyl 2-[(3-chloro-2-hydroxypropyl)amino]-4,5-diethoxybenzoate |
|---|---|
| PubChem CID | 168640097 |
| Molecular Formula | C15H22ClNO5 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | methyl 2-[(3-chloro-2-hydroxypropyl)amino]-4,5-diethoxybenzoate |
| SMILES | CCOc1cc(NCC(O)CCl)c(C(=O)OC)cc1OCC |
| InChI | InChI=1S/C15H22ClNO5/c1-4-21-13-6-11(15(19)20-3)12(7-14(13)22-5-2)17-9-10(18)8-16/h6-7,10,17-18H,4-5,8-9H2,1-3H3 |
| InChIKey | NOJNWLZJBLQMDW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|