C17H27ClN2O4 — CID 168640055
N-[2-[5-[(3-chloro-2-hydroxypropyl)amino]-2-methoxy-4-propylphenoxy]ethyl]acetamide (PubChem CID 168640055) has the molecular formula C17H27ClN2O4 and a molecular weight of 358.87 g/mol. Its IUPAC name is N-[2-[5-[(3-chloro-2-hydroxypropyl)amino]-2-methoxy-4-propylphenoxy]ethyl]acetamide.
| Compound Name | N-[2-[5-[(3-chloro-2-hydroxypropyl)amino]-2-methoxy-4-propylphenoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 168640055 |
| Molecular Formula | C17H27ClN2O4 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[2-[5-[(3-chloro-2-hydroxypropyl)amino]-2-methoxy-4-propylphenoxy]ethyl]acetamide |
| SMILES | CCCc1cc(OC)c(OCCNC(C)=O)cc1NCC(O)CCl |
| InChI | InChI=1S/C17H27ClN2O4/c1-4-5-13-8-16(23-3)17(24-7-6-19-12(2)21)9-15(13)20-11-14(22)10-18/h8-9,14,20,22H,4-7,10-11H2,1-3H3,(H,19,21) |
| InChIKey | AUVRMOCPECJUFD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|