C15H19NO5 — CID 97034323
methyl (E)-3-[4-(2-acetamidoethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 97034323) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is methyl (E)-3-[4-(2-acetamidoethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-(2-acetamidoethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 97034323 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | methyl (E)-3-[4-(2-acetamidoethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(OCCNC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C15H19NO5/c1-11(17)16-8-9-21-13-6-4-12(10-14(13)19-2)5-7-15(18)20-3/h4-7,10H,8-9H2,1-3H3,(H,16,17)/b7-5+ |
| InChIKey | BTAHLFOSYUBWSX-FNORWQNLSA-N |
| XLogP | 1.40 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|