C36H48N2O10 — CID 126635920
tert-butyl N-[2-[2-methoxy-4-[(1E,6E)-7-[3-methoxy-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]-4-methyl-3,5-dioxohepta-1,6-dienyl]phenoxy]ethyl]carbamate (PubChem CID 126635920) has the molecular formula C36H48N2O10 and a molecular weight of 668.78 g/mol. Its IUPAC name is tert-butyl N-[2-[2-methoxy-4-[(1E,6E)-7-[3-methoxy-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]-4-methyl-3,5-dioxohepta-1,6-dienyl]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-methoxy-4-[(1E,6E)-7-[3-methoxy-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]-4-methyl-3,5-dioxohepta-1,6-dienyl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 126635920 |
| Molecular Formula | C36H48N2O10 |
| Molecular Weight | 668.78 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | tert-butyl N-[2-[2-methoxy-4-[(1E,6E)-7-[3-methoxy-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]-4-methyl-3,5-dioxohepta-1,6-dienyl]phenoxy]ethyl]carbamate |
| SMILES | COc1cc(/C=C/C(=O)C(C)C(=O)/C=C/c2ccc(OCCNC(=O)OC(C)(C)C)c(OC)c2)ccc1OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H48N2O10/c1-24(27(39)14-10-25-12-16-29(31(22-25)43-8)45-20-18-37-33(41)47-35(2,3)4)28(40)15-11-26-13-17-30(32(23-26)44-9)46-21-19-38-34(42)48-36(5,6)7/h10-17,22-24H,18-21H2,1-9H3,(H,37,41)(H,38,42)/b14-10+,15-11+ |
| InChIKey | AGZILEAHSPJFRW-WFYKWJGLSA-N |
| XLogP | 6.01 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.78 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|