C30H37NO8 — CID 126636025
tert-butyl N-[(E)-6-(3,4-dimethoxyphenyl)-3-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-oxohex-5-enyl]carbamate (PubChem CID 126636025) has the molecular formula C30H37NO8 and a molecular weight of 539.63 g/mol. Its IUPAC name is tert-butyl N-[(E)-6-(3,4-dimethoxyphenyl)-3-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-oxohex-5-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-6-(3,4-dimethoxyphenyl)-3-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-oxohex-5-enyl]carbamate |
|---|---|
| PubChem CID | 126636025 |
| Molecular Formula | C30H37NO8 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | tert-butyl N-[(E)-6-(3,4-dimethoxyphenyl)-3-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-oxohex-5-enyl]carbamate |
| SMILES | COc1ccc(/C=C/C(=O)C(CCNC(=O)OC(C)(C)C)C(=O)/C=C/c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C30H37NO8/c1-30(2,3)39-29(34)31-17-16-22(23(32)12-8-20-10-14-25(35-4)27(18-20)37-6)24(33)13-9-21-11-15-26(36-5)28(19-21)38-7/h8-15,18-19,22H,16-17H2,1-7H3,(H,31,34)/b12-8+,13-9+ |
| InChIKey | JDHADGWQOMRVKQ-QHKWOANTSA-N |
| XLogP | 5.12 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|