C26H40N4O7 — CID 10864266
tert-butyl N-[N'-[4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]butyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 10864266) has the molecular formula C26H40N4O7 and a molecular weight of 520.63 g/mol. Its IUPAC name is tert-butyl N-[N'-[4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]butyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]butyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 10864266 |
| Molecular Formula | C26H40N4O7 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | tert-butyl N-[N'-[4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]butyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | COc1ccc(/C=C/C(=O)NCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc1OC |
| InChI | InChI=1S/C26H40N4O7/c1-25(2,3)36-23(32)29-22(30-24(33)37-26(4,5)6)28-16-10-9-15-27-21(31)14-12-18-11-13-19(34-7)20(17-18)35-8/h11-14,17H,9-10,15-16H2,1-8H3,(H,27,31)(H2,28,29,30,32,33)/b14-12+ |
| InChIKey | MOIAKFGAFSCIBH-WYMLVPIESA-N |
| XLogP | 4.02 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|