C29H35NO8 — CID 126613894
tert-butyl N-[2-[4-[(1E,6E)-7-(3,4-dimethoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenoxy]ethyl]carbamate (PubChem CID 126613894) has the molecular formula C29H35NO8 and a molecular weight of 525.60 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(1E,6E)-7-(3,4-dimethoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[(1E,6E)-7-(3,4-dimethoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 126613894 |
| Molecular Formula | C29H35NO8 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | tert-butyl N-[2-[4-[(1E,6E)-7-(3,4-dimethoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenoxy]ethyl]carbamate |
| SMILES | COc1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OCCNC(=O)OC(C)(C)C)c(OC)c2)cc1OC |
| InChI | InChI=1S/C29H35NO8/c1-29(2,3)38-28(33)30-15-16-37-25-14-10-21(18-27(25)36-6)8-12-23(32)19-22(31)11-7-20-9-13-24(34-4)26(17-20)35-5/h7-14,17-18H,15-16,19H2,1-6H3,(H,30,33)/b11-7+,12-8+ |
| InChIKey | RKYDRHWWNVTRBT-MKICQXMISA-N |
| XLogP | 4.87 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|