C20H31BrN2O6 — CID 170106812
tert-butyl N-[2-[4-bromo-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenoxy]ethyl]carbamate (PubChem CID 170106812) has the molecular formula C20H31BrN2O6 and a molecular weight of 475.38 g/mol. Its IUPAC name is tert-butyl N-[2-[4-bromo-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-bromo-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 170106812 |
| Molecular Formula | C20H31BrN2O6 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | tert-butyl N-[2-[4-bromo-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc(Br)cc1OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31BrN2O6/c1-19(2,3)28-17(24)22-9-11-26-15-8-7-14(21)13-16(15)27-12-10-23-18(25)29-20(4,5)6/h7-8,13H,9-12H2,1-6H3,(H,22,24)(H,23,25) |
| InChIKey | FNLTUDCNRMBONN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|