C16H28N2O3 — CID 142077539
tert-butyl N-[2-[(2,6-dimethyl-3-pyridinyl)oxy]ethyl]carbamate;ethane (PubChem CID 142077539) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is tert-butyl N-[2-[(2,6-dimethyl-3-pyridinyl)oxy]ethyl]carbamate;ethane.
| Compound Name | tert-butyl N-[2-[(2,6-dimethyl-3-pyridinyl)oxy]ethyl]carbamate;ethane |
|---|---|
| PubChem CID | 142077539 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | tert-butyl N-[2-[(2,6-dimethyl-3-pyridinyl)oxy]ethyl]carbamate;ethane |
| SMILES | CC.Cc1ccc(OCCNC(=O)OC(C)(C)C)c(C)n1 |
| InChI | InChI=1S/C14H22N2O3.C2H6/c1-10-6-7-12(11(2)16-10)18-9-8-15-13(17)19-14(3,4)5;1-2/h6-7H,8-9H2,1-5H3,(H,15,17);1-2H3 |
| InChIKey | ANKJXLAGIXJUCD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|