C13H17BrINO3 — CID 175686769
tert-butyl N-[2-(3-bromo-5-iodophenoxy)ethyl]carbamate (PubChem CID 175686769) has the molecular formula C13H17BrINO3 and a molecular weight of 442.09 g/mol. Its IUPAC name is tert-butyl N-[2-(3-bromo-5-iodophenoxy)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-bromo-5-iodophenoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 175686769 |
| Molecular Formula | C13H17BrINO3 |
| Molecular Weight | 442.09 g/mol |
| Exact Mass | 440.94 |
| IUPAC Name | tert-butyl N-[2-(3-bromo-5-iodophenoxy)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1cc(Br)cc(I)c1 |
| InChI | InChI=1S/C13H17BrINO3/c1-13(2,3)19-12(17)16-4-5-18-11-7-9(14)6-10(15)8-11/h6-8H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | VFMVWYBMXINWQW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.09 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|