C15H18BrN3O3 — CID 86669526
tert-butyl N-[2-(2-bromoquinazolin-6-yl)oxyethyl]carbamate (PubChem CID 86669526) has the molecular formula C15H18BrN3O3 and a molecular weight of 368.23 g/mol. Its IUPAC name is tert-butyl N-[2-(2-bromoquinazolin-6-yl)oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-bromoquinazolin-6-yl)oxyethyl]carbamate |
|---|---|
| PubChem CID | 86669526 |
| Molecular Formula | C15H18BrN3O3 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | tert-butyl N-[2-(2-bromoquinazolin-6-yl)oxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc2nc(Br)ncc2c1 |
| InChI | InChI=1S/C15H18BrN3O3/c1-15(2,3)22-14(20)17-6-7-21-11-4-5-12-10(8-11)9-18-13(16)19-12/h4-5,8-9H,6-7H2,1-3H3,(H,17,20) |
| InChIKey | ULCVQWPLBFCFJC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|