C32H32O6 — CID 91286351
1,7-bis(3,4-dimethoxyphenyl)-4-(3-phenylprop-2-enyl)hepta-1,6-diene-3,5-dione (PubChem CID 91286351) has the molecular formula C32H32O6 and a molecular weight of 512.60 g/mol. Its IUPAC name is 1,7-bis(3,4-dimethoxyphenyl)-4-(3-phenylprop-2-enyl)hepta-1,6-diene-3,5-dione.
| Compound Name | 1,7-bis(3,4-dimethoxyphenyl)-4-(3-phenylprop-2-enyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 91286351 |
| Molecular Formula | C32H32O6 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 1,7-bis(3,4-dimethoxyphenyl)-4-(3-phenylprop-2-enyl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1ccc(C=CC(=O)C(CC=Cc2ccccc2)C(=O)C=Cc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C32H32O6/c1-35-29-19-15-24(21-31(29)37-3)13-17-27(33)26(12-8-11-23-9-6-5-7-10-23)28(34)18-14-25-16-20-30(36-2)32(22-25)38-4/h5-11,13-22,26H,12H2,1-4H3 |
| InChIKey | XBIGFOPLOQFCKU-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|