C27H32O6 — CID 123338406
(1E,6E)-1-[3,4-bis(hydroxymethyl)phenyl]-4-butyl-7-(3,4-dimethoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 123338406) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is (1E,6E)-1-[3,4-bis(hydroxymethyl)phenyl]-4-butyl-7-(3,4-dimethoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-[3,4-bis(hydroxymethyl)phenyl]-4-butyl-7-(3,4-dimethoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 123338406 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (1E,6E)-1-[3,4-bis(hydroxymethyl)phenyl]-4-butyl-7-(3,4-dimethoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | CCCCC(C(=O)/C=C/c1ccc(CO)c(CO)c1)C(=O)/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C27H32O6/c1-4-5-6-23(24(30)12-8-19-7-11-21(17-28)22(15-19)18-29)25(31)13-9-20-10-14-26(32-2)27(16-20)33-3/h7-16,23,28-29H,4-6,17-18H2,1-3H3/b12-8+,13-9+ |
| InChIKey | NFFRBUUXOZDXPT-QHKWOANTSA-N |
| XLogP | 4.36 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|