C24H21F2NaO6 — CID 58556803
sodium (E)-4-[(E)-3-[3-fluoro-4-(hydroxymethyl)phenyl]prop-2-enoyl]-7-(3-fluoro-4-methoxyphenyl)-5-oxohept-6-enoate (PubChem CID 58556803) has the molecular formula C24H21F2NaO6 and a molecular weight of 466.41 g/mol. Its IUPAC name is sodium (E)-4-[(E)-3-[3-fluoro-4-(hydroxymethyl)phenyl]prop-2-enoyl]-7-(3-fluoro-4-methoxyphenyl)-5-oxohept-6-enoate.
| Compound Name | sodium (E)-4-[(E)-3-[3-fluoro-4-(hydroxymethyl)phenyl]prop-2-enoyl]-7-(3-fluoro-4-methoxyphenyl)-5-oxohept-6-enoate |
|---|---|
| PubChem CID | 58556803 |
| Molecular Formula | C24H21F2NaO6 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | sodium (E)-4-[(E)-3-[3-fluoro-4-(hydroxymethyl)phenyl]prop-2-enoyl]-7-(3-fluoro-4-methoxyphenyl)-5-oxohept-6-enoate |
| SMILES | COc1ccc(/C=C/C(=O)C(CCC(=O)[O-])C(=O)/C=C/c2ccc(CO)c(F)c2)cc1F.[Na+] |
| InChI | InChI=1S/C24H22F2O6.Na/c1-32-23-10-5-16(13-20(23)26)4-9-22(29)18(7-11-24(30)31)21(28)8-3-15-2-6-17(14-27)19(25)12-15;/h2-6,8-10,12-13,18,27H,7,11,14H2,1H3,(H,30,31);/q;+1/p-1/b8-3+,9-4+; |
| InChIKey | RBGOSHSMCVMQTO-OHBYXFRFSA-M |
| XLogP | -0.52 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|