C14H16FNO5 — CID 107822334
(2S)-2-[[(E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoyl]amino]-4-hydroxybutanoic acid (PubChem CID 107822334) has the molecular formula C14H16FNO5 and a molecular weight of 297.28 g/mol. Its IUPAC name is (2S)-2-[[(E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoyl]amino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[[(E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107822334 |
| Molecular Formula | C14H16FNO5 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (2S)-2-[[(E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoyl]amino]-4-hydroxybutanoic acid |
| SMILES | COc1ccc(/C=C/C(=O)N[C@@H](CCO)C(=O)O)cc1F |
| InChI | InChI=1S/C14H16FNO5/c1-21-12-4-2-9(8-10(12)15)3-5-13(18)16-11(6-7-17)14(19)20/h2-5,8,11,17H,6-7H2,1H3,(H,16,18)(H,19,20)/b5-3+/t11-/m0/s1 |
| InChIKey | GIDVXPIAKHIQDS-TZNOJPMFSA-N |
| XLogP | 0.80 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|