C16H22N2O5 — CID 25051030
(2R)-6-amino-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]hexanoic acid (PubChem CID 25051030) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is (2R)-6-amino-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]hexanoic acid.
| Compound Name | (2R)-6-amino-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 25051030 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (2R)-6-amino-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]hexanoic acid |
| SMILES | COc1cc(/C=C/C(=O)N[C@H](CCCCN)C(=O)O)ccc1O |
| InChI | InChI=1S/C16H22N2O5/c1-23-14-10-11(5-7-13(14)19)6-8-15(20)18-12(16(21)22)4-2-3-9-17/h5-8,10,12,19H,2-4,9,17H2,1H3,(H,18,20)(H,21,22)/b8-6+/t12-/m1/s1 |
| InChIKey | JLIVGXIQGDYOGO-WAFBPQNNSA-N |
| XLogP | 1.11 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|